Ginsenoside Rg4 structure
|
Common Name | Ginsenoside Rg4 | ||
|---|---|---|---|---|
| CAS Number | 126223-28-7 | Molecular Weight | 766.998 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 860.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C42H70O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 474.0±34.3 °C | |
Use of Ginsenoside Rg4Ginsenoside Rg4 is a major protopanaxatriol type ginsenoside isolated from the leaves of Panax ginseng C. A. Meyer. The protopanaxatriol type ginsenosides (such as Ginsenoside Rg4) exhibits various biological activities including anti-septic, anti-diabetic, wound healing, immune-stimulatory, and anti-antioxidant activity[1][2]. |
| Name | (6β,8ξ,9ξ,12α,13α,14β,17β)-4-Ethyl-3,12-dihydroxy-4,10,14-trimeth yl-17-[(2Z)-6-methyl-2,5-heptadien-2-yl]gonan-6-yl 2-O-(6-deoxy-α -L-mannopyranosyl)-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Ginsenoside Rg4 is a major protopanaxatriol type ginsenoside isolated from the leaves of Panax ginseng C. A. Meyer. The protopanaxatriol type ginsenosides (such as Ginsenoside Rg4) exhibits various biological activities including anti-septic, anti-diabetic, wound healing, immune-stimulatory, and anti-antioxidant activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 860.2±65.0 °C at 760 mmHg |
| Molecular Formula | C42H70O12 |
| Molecular Weight | 766.998 |
| Flash Point | 474.0±34.3 °C |
| Exact Mass | 766.486755 |
| PSA | 198.76000 |
| LogP | 8.37 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | QOMBXPYXWGTFNR-KRPFXEAISA-N |
| SMILES | CC(C)=CCC=C(C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3C(OC3OC(CO)C(O)C(O)C3OC3OC(C)C(O)C(O)C3O)CC12C |
| β-D-Glucopyranoside, (6β,8ξ,9ξ,12α,13α,14β,17β)-17-[(1Z)-1,5-dimethyl-1,4-hexadien-1-yl]-4-ethyl-3,12-dihydroxy-4,10,14-trimethylgonan-6-yl 2-O-(6-deoxy-α-L-mannopyranosyl)- |
| (6β,8ξ,9ξ,12α,13α,14β,20Z)-4-Ethyl-3,12-dihydroxy-4,14-dimethyl-18-norcholesta-20(22),24-dien-6-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |