(R)-CPP(mM/ml) structure
|
Common Name | (R)-CPP(mM/ml) | ||
|---|---|---|---|---|
| CAS Number | 126453-07-4 | Molecular Weight | 252.20500 | |
| Density | 1.408g/cm3 | Boiling Point | 546.7ºC at 760 mmHg | |
| Molecular Formula | C8H17N2O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.4ºC | |
Use of (R)-CPP(mM/ml)(R)-CPP is a highly potent NMDA receptor antagonist[1]. |
| Name | (r)-cpp |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-CPP is a highly potent NMDA receptor antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 546.7ºC at 760 mmHg |
| Molecular Formula | C8H17N2O5P |
| Molecular Weight | 252.20500 |
| Flash Point | 284.4ºC |
| Exact Mass | 252.08800 |
| PSA | 119.91000 |
| Vapour Pressure | 2.14E-13mmHg at 25°C |
| Index of Refraction | 1.53 |
| InChIKey | CUVGUPIVTLGRGI-SSDOTTSWSA-N |
| SMILES | O=C(O)C1CN(CCCP(=O)(O)O)CCN1 |
|
~74%
(R)-CPP(mM/ml) CAS#:126453-07-4 |
| Literature: Aebischer; Frey; Haerter; Herrling; Mueller; Olverman; Watkins Helvetica Chimica Acta, 1989 , vol. 72, # 5 p. 1043 - 1051 |
|
~%
(R)-CPP(mM/ml) CAS#:126453-07-4 |
| Literature: Helvetica Chimica Acta, , vol. 72, # 5 p. 1043 - 1051 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| L-2-Phenyl-propionamid |