CDK-IN-2 structure
|
Common Name | CDK-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 1269815-17-9 | Molecular Weight | 363.81400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19ClFN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CDK-IN-2CDK-IN-2 is a potent and specific CDK9 inhibitor with IC50 of <8 nM, extracted from reference 1, example 4.IC50 Value: <8 nM [1]Target: CDK9In vitro:In vivo: |
| Name | (3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)pyridin-2-yl]piperidine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Description | CDK-IN-2 is a potent and specific CDK9 inhibitor with IC50 of <8 nM, extracted from reference 1, example 4.IC50 Value: <8 nM [1]Target: CDK9In vitro:In vivo: |
|---|---|
| Related Catalog | |
| Target |
CDK9/cyclinT1:8 nM (IC50) |
| References |
[1]. Keith B Pfister, et al. Heteroaryl compounds as kinase inhibitors. 2011, WO2011026917A1. |
| Molecular Formula | C18H19ClFN3O2 |
|---|---|
| Molecular Weight | 363.81400 |
| Exact Mass | 363.11500 |
| PSA | 66.74000 |
| LogP | 4.46610 |
| InChIKey | AHMKHNVZGOQLRQ-LLVKDONJSA-N |
| SMILES | COc1ccc(F)cc1-c1cc(NC(=O)C2CCCNC2)ncc1Cl |
| Storage condition | 2-8℃ |
| (R)-piperidine-3-carboxylic acid [5-chloro-4-(5-fluoro-2-methoxyphenyl)-pyridin-2-yl]-amide |
| (R)-N-(5-chloro-4-(5-fluoro-2-methoxyphenyl)pyridin-2-yl)piperidine-3-carboxamide trifluoroacetate |
| CDK inhibitor II| |
| CDK-IN-2 |