Benzyl-PEG4-acid structure
|
Common Name | Benzyl-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 127457-64-1 | Molecular Weight | 312.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzyl-PEG4-acidBenzyl-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
| Name | Benzyl-PEG4-acid |
|---|
| Description | Benzyl-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins. |
| References |
| Molecular Formula | C16H24O6 |
|---|---|
| Molecular Weight | 312.36 |
| InChIKey | FGLPTVPWFDQWFM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCc1ccccc1 |