Fenoterol-d6 hydrobromide structure
|
Common Name | Fenoterol-d6 hydrobromide | ||
|---|---|---|---|---|
| CAS Number | 1286129-04-1 | Molecular Weight | 390.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16BrD6NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fenoterol-d6 hydrobromideFenoterol-d6 hydrobromide (Th-1165a-d6) is the deuterium labeled Fenoterol hydrobromide. Fenoterol hydrobromide (Th-1165a), a sympathomimetic agent, is a selective and orally active β2-adrenoceptor agonist. Fenoterol hydrobromide is an effective bronchodilator and can be used for bronchospasm associated with asthma, bronchitis and other obstructive airway diseases research[1][2]. |
| Name | 5-[2-[[1,1,1,2,3,3-hexadeuterio-3-(4-hydroxyphenyl)propan-2-yl]amino]-1-hydroxyethyl]benzene-1,3-diol,hydrobromide |
|---|---|
| Synonym | More Synonyms |
| Description | Fenoterol-d6 hydrobromide (Th-1165a-d6) is the deuterium labeled Fenoterol hydrobromide. Fenoterol hydrobromide (Th-1165a), a sympathomimetic agent, is a selective and orally active β2-adrenoceptor agonist. Fenoterol hydrobromide is an effective bronchodilator and can be used for bronchospasm associated with asthma, bronchitis and other obstructive airway diseases research[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C17H16BrD6NO4 |
|---|---|
| Molecular Weight | 390.30200 |
| Exact Mass | 389.11100 |
| PSA | 92.95000 |
| LogP | 3.40660 |
| InChIKey | SGZRQMALQBXAIQ-JOJSIGTQSA-N |
| SMILES | Br.CC(Cc1ccc(O)cc1)NCC(O)c1cc(O)cc(O)c1 |
| Fenoterol-d6 Hydrobromide |
| Airum-d6 |
| Partusisten-d6 |
| Berotec-d6 |
| Phenoterol-d6 Hydrobromide |
| Fenoterol-d6 Bromide |
| Dosberotec-d6 |
| Th 1165a-d6 |