Cbz-NH-PEG3-C2-acid structure
|
Common Name | Cbz-NH-PEG3-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 1310327-18-4 | Molecular Weight | 355.383 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 542.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H25NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.0±30.1 °C | |
Use of Cbz-NH-PEG3-C2-acidCbz-NH-PEG3-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Cbz-N-amido-PEG3-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-NH-PEG3-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.7±50.0 °C at 760 mmHg |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.383 |
| Flash Point | 282.0±30.1 °C |
| Exact Mass | 355.163116 |
| LogP | 0.83 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | SBHUTZVKPJPFBD-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCNC(=O)OCc1ccccc1 |
| CBZ-N-AMIDO-PEG3-COOH |