4,4'-Methylenebis(2,6-dimethylphenol) structure
|
Common Name | 4,4'-Methylenebis(2,6-dimethylphenol) | ||
|---|---|---|---|---|
| CAS Number | 5384-21-4 | Molecular Weight | 256.340 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 414.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C17H20O2 | Melting Point | 176ºC | |
| MSDS | N/A | Flash Point | 193.6±21.9 °C | |
| Name | 4,4'-Methylenebis(2,6-dimethylphenol) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 414.7±40.0 °C at 760 mmHg |
| Melting Point | 176ºC |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.340 |
| Flash Point | 193.6±21.9 °C |
| Exact Mass | 256.146332 |
| PSA | 40.46000 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | AZZWZMUXHALBCQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2)cc(C)c1O |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2907299090 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| EINECS 226-378-9 |
| Bis(4-hydroxy-3,5-dimethylphenyl)methane |
| Phenol, 4,4'-methylenebis[2,6-dimethyl- |
| 4,4'-Dihydroxy-3,3',5,5'-tetramethyldiphenylmethane |
| 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol |
| 2,2',6,6'-Tetramethyl-4,4'-methylenediphenol |
| 4,4'-methanediylbis(2,6-dimethylphenol) |
| Bis(3,5-dimethyl-4-hydroxyphenyl)methane |
| 4,4'-Methylenebis(2,6-dimethylphenol) |