Fmoc-His(MMt)-OH structure
|
Common Name | Fmoc-His(MMt)-OH | ||
|---|---|---|---|---|
| CAS Number | 133367-33-6 | Molecular Weight | 649.73400 | |
| Density | 1.247g/cm3 | Boiling Point | 835.665ºC at 760 mmHg | |
| Molecular Formula | C41H35N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 459.194ºC | |
Use of Fmoc-His(MMt)-OHFmoc-His(MMt)-OH is a histidine derivative[1]. |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(4-methoxyphenyl)-diphenylmethyl]imidazol-4-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-His(MMt)-OH is a histidine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 835.665ºC at 760 mmHg |
| Molecular Formula | C41H35N3O5 |
| Molecular Weight | 649.73400 |
| Flash Point | 459.194ºC |
| Exact Mass | 649.25800 |
| PSA | 102.68000 |
| LogP | 7.65720 |
| Index of Refraction | 1.647 |
| InChIKey | RWXYQHDPFNGLFW-LHEWISCISA-N |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccccc2)n2cnc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)c2)cc1 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-1-[(4-methoxyphenyl)diphenylmethyl]-L-histidine |
| Fmoc-His(MMt)-OH |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-((4-methoxyphenyl)diphenylmethyl)-1H-imidazol-4-yl)propanoic acid |
| AmbotzFAA1070 |