Fmoc-His(Mtt)-OH structure
|
Common Name | Fmoc-His(Mtt)-OH | ||
|---|---|---|---|---|
| CAS Number | 133367-34-7 | Molecular Weight | 633.73400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H35N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-His(Mtt)-OHFmoc-His(Mtt)-OH is a histidine derivative protected by Fmoc, can be used for the synthesis of drugs or other compounds[1]. |
| Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[1-[(4-methylphenyl)-diphenylmethyl]imidazol-4-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-His(Mtt)-OH is a histidine derivative protected by Fmoc, can be used for the synthesis of drugs or other compounds[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C41H35N3O4 |
|---|---|
| Molecular Weight | 633.73400 |
| Exact Mass | 633.26300 |
| PSA | 93.45000 |
| LogP | 7.95700 |
| InChIKey | MNOCIIYDYLYWEU-LHEWISCISA-N |
| SMILES | Cc1ccc(C(c2ccccc2)(c2ccccc2)n2cnc(CC(NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)c2)cc1 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| AmbotzFAA1080 |
| Fmoc-His(Mtt)-OH |