PERK-IN-3 structure
|
Common Name | PERK-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1337532-08-7 | Molecular Weight | 406.38 | |
| Density | 1.446±0.06 g/cm3(Predicted) | Boiling Point | 694.8±55.0 °C(Predicted) | |
| Molecular Formula | C22H16F2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PERK-IN-3PERK-IN-3 is a potent PERK inhibitor with an IC50 of 7.4 nM[1]. |
| Name | PERK-IN-3 |
|---|
| Description | PERK-IN-3 is a potent PERK inhibitor with an IC50 of 7.4 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 7.4 nM (PERK)[1] |
| References |
| Density | 1.446±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 694.8±55.0 °C(Predicted) |
| Molecular Formula | C22H16F2N4O2 |
| Molecular Weight | 406.38 |
| InChIKey | VODMNNHLALPLST-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2occ(-c3ccc4c(c3)CCN4C(=O)Cc3cc(F)ccc3F)c12 |
| Storage condition | -20°C |