PBK-IN-9 structure
|
Common Name | PBK-IN-9 | ||
|---|---|---|---|---|
| CAS Number | 1338540-55-8 | Molecular Weight | 350.434 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 498.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H18N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.4±28.7 °C | |
Use of PBK-IN-9PBK-IN-9 (compound 1160) is a potent PDZ binding kinase (PBK) inhibitor[1]. |
| Name | OTS514 |
|---|---|
| Synonym | More Synonyms |
| Description | PBK-IN-9 (compound 1160) is a potent PDZ binding kinase (PBK) inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Yusuke Nakamura, et al. Trycyclic compounds and pbk inhibitors containing the same. WO2011123419A1. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.7±45.0 °C at 760 mmHg |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.434 |
| Flash Point | 255.4±28.7 °C |
| Exact Mass | 350.108887 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | GBOYXCBUDIJBBZ-UHFFFAOYSA-N |
| SMILES | CC(CN)c1ccc(-c2c(O)ccc3[nH]c(=O)c4sccc4c23)cc1 |
| 9-{4-[(2R)-1-Amino-2-propanyl]phenyl}-8-hydroxythieno[2,3-c]quinolin-4(5H)-one |
| Thieno[2,3-c]quinolin-4(5H)-one, 9-[4-[(1R)-2-amino-1-methylethyl]phenyl]-8-hydroxy- |