Diacetolol D7 structure
|
Common Name | Diacetolol D7 | ||
|---|---|---|---|---|
| CAS Number | 1346604-19-0 | Molecular Weight | 315.416 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 548.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H17D7N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.7±30.1 °C | |
Use of Diacetolol D7Diacetolol D7 is a deuterium labeled Diacetolol. Diacetolol is the major metabolite of Acebutolol. Diacetolol is a β-adrenoceptor blocking and anti-arrhythmic agent[1]. |
| Name | N-(3-Acetyl-4-{2-hydroxy-3-[(2H7)-2-propanylamino]propoxy}phenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Diacetolol D7 is a deuterium labeled Diacetolol. Diacetolol is the major metabolite of Acebutolol. Diacetolol is a β-adrenoceptor blocking and anti-arrhythmic agent[1]. |
|---|---|
| Related Catalog | |
| Target |
β-adrenoceptor[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.8±50.0 °C at 760 mmHg |
| Molecular Formula | C16H17D7N2O4 |
| Molecular Weight | 315.416 |
| Flash Point | 285.7±30.1 °C |
| Exact Mass | 315.217529 |
| LogP | 0.89 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | AWOGXJOBNAWQSF-SVMCCORHSA-N |
| SMILES | CC(=O)Nc1ccc(OCC(O)CNC(C)C)c(C(C)=O)c1 |
| N-(3-Acetyl-4-{2-hydroxy-3-[(2H7)-2-propanylamino]propoxy}phenyl)acetamide |
| Acetamide, N-[3-acetyl-4-[2-hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]phenyl]- |