Phenylethanolamine A structure
|
Common Name | Phenylethanolamine A | ||
|---|---|---|---|---|
| CAS Number | 1346746-81-3 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Phenylethanolamine APhenylethanolamine A acts as a β-adrenergic agonist. Phenylethanolamine A is a byproduct during the Ractopamine synthesis process[1]. |
| Name | Phenylethanolamine A |
|---|
| Description | Phenylethanolamine A acts as a β-adrenergic agonist. Phenylethanolamine A is a byproduct during the Ractopamine synthesis process[1]. |
|---|---|
| Related Catalog | |
| References |
| InChIKey | DVUFPRMEKXKECP-UHFFFAOYSA-N |
|---|---|
| SMILES | COc1ccc(C(O)CNC(C)CCc2ccc([N+](=O)[O-])cc2)cc1 |