Z-Hyp-OH structure
|
Common Name | Z-Hyp-OH | ||
|---|---|---|---|---|
| CAS Number | 13504-85-3 | Molecular Weight | 265.26 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 486.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | 104-107 °C | |
| MSDS | Chinese USA | Flash Point | 248.3±28.7 °C | |
Use of Z-Hyp-OHN-Cbz-hydroxy-L-proline is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | N-Cbz-Hydroxy-L-proline |
|---|---|
| Synonym | More Synonyms |
| Description | N-Cbz-hydroxy-L-proline is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.9±45.0 °C at 760 mmHg |
| Melting Point | 104-107 °C |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 |
| Flash Point | 248.3±28.7 °C |
| Exact Mass | 265.095032 |
| PSA | 87.07000 |
| LogP | -0.10 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | WWVCWLBEARZMAH-MNOVXSKESA-N |
| SMILES | O=C(O)C1CC(O)CN1C(=O)OCc1ccccc1 |
| Storage condition | Store at RT. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~99%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 10, # 16 p. 1845 - 1847 |
|
~99%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: US2003/120069 A1, ; |
|
~99%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: Tetrahedron Letters, , vol. 33, # 37 p. 5441 - 5444 |
|
~3%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: JP2005/112761 A, ; Page/Page column 8 ; |
|
~%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, , vol. 62, # 11 p. 1459 - 1464 |
|
~%
Z-Hyp-OH CAS#:13504-85-3 |
| Literature: Tetrahedron Letters, , vol. 45, # 32 p. 6097 - 6100 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| CBZ-L-HYDROXYPROLINE |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester, (2S,4R)- |
| N-Cbz-Hydroxy-L-prol |
| trans-N-Cbz-4-hydroxy-L-proline |
| 1-[(Benzyloxy)carbonyl]-4-hydroxyproline |
| trans-N-Carbobenzoxy-4-hydroxy-L-proline |
| Z-L-HYP-OH |
| (4R)-1-[(Benzyloxy)carbonyl]-4-hydroxy-L-proline |
| Z-HYDROXYPROLINE |
| Z-HYP-OH |
| N-Cbz-trans-4-hydroxy-L-proline |
| MFCD00037329 |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(phenylmethyl) ester |
| Cbz-D-Hyp-OH |
| Z-L-4-HYDROXYPROLINE |
| EINECS 236-831-2 |
| CBZ-L-HYP-OH |
| Z-L-HYDROXYPROLINE |
| CBZ-HYP-OH |
| Benzyloxycarbonyl-L-4-hydroxyproline |