N-Carbobenzoxy-4-oxo-L-proline structure
|
Common Name | N-Carbobenzoxy-4-oxo-L-proline | ||
|---|---|---|---|---|
| CAS Number | 64187-47-9 | Molecular Weight | 263.246 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 488.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO5 | Melting Point | 95℃ | |
| MSDS | Chinese USA | Flash Point | 249.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-Carbobenzyloxy-4-keto-L-proline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.5±45.0 °C at 760 mmHg |
| Melting Point | 95℃ |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.246 |
| Flash Point | 249.2±28.7 °C |
| Exact Mass | 263.079376 |
| PSA | 83.91000 |
| LogP | 0.18 |
| Appearance of Characters | Powder | White to yellow to brown |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | RPLLCMZOIFOBIF-NSHDSACASA-N |
| SMILES | O=C1CC(C(=O)O)N(C(=O)OCc2ccccc2)C1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36-37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~90%
N-Carbobenzoxy-... CAS#:64187-47-9 |
| Literature: Tetrahedron Asymmetry, , vol. 17, # 17 p. 2479 - 2486 |
|
~81%
N-Carbobenzoxy-... CAS#:64187-47-9 |
| Literature: US2004/77879 A1, ; Page 13 ; |
|
~%
N-Carbobenzoxy-... CAS#:64187-47-9 |
| Literature: Tetrahedron Asymmetry, , vol. 17, # 17 p. 2479 - 2486 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Carbobenzyloxy-4-keto-L-proline |
| 1-[(Benzyloxy)carbonyl]-4-oxo-L-proline |
| (2S)-4-oxo-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| N-Carbobenzoxy-4-oxo-L-proline |
| (S)-1-(benzyloxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid |