Boc-Asp-OH structure
|
Common Name | Boc-Asp-OH | ||
|---|---|---|---|---|
| CAS Number | 13726-67-5 | Molecular Weight | 353.327 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 609.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H19N3O7 | Melting Point | 116-118 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 322.3±31.5 °C | |
Use of Boc-Asp-OHBoc-Asp-OH is an aspartic acid derivative[1]. |
| Name | Boc-Asp-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Asp-OH is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 609.3±55.0 °C at 760 mmHg |
| Melting Point | 116-118 °C(lit.) |
| Molecular Formula | C15H19N3O7 |
| Molecular Weight | 353.327 |
| Flash Point | 322.3±31.5 °C |
| Exact Mass | 353.122314 |
| PSA | 112.93000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | KAJBMCZQVSQJDE-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C(=O)O |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Aspartic acid-based modified PLGA–PEG nanoparticles for bone targeting: In vitro and in vivo evaluation
Acta Biomater. 10(11) , 4583-96, (2014) Bone targeting NPs comprised of dendritic trimer of aspartic acid functionalized PLGA-PEG copolymers could be the foundation for hydrophobic-drug therapies. |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)succinic acid |
| EINECS 237-294-7 |
| tert-butyloxycarbonyl-L-aspartic acid |
| BOC-ASP |
| L-Aspartic acid, N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-L-aspartic acid |
| L-Asparagine, N-[(1,1-dimethylethoxy)carbonyl]-, 4-nitrophenyl ester |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-aspartic acid |
| BOC-L-ASP |
| N-t-butyloxycarbonyl-L-aspartic acid |
| BOC-ASPARTIC ACID |
| N-BOC-L-aspartic acid |
| L-Asparagine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester |
| N-Boc-aspartic acid |
| N-tert-Butoxycarbonyl-L-aspartic acid |
| tert-Butoxycarbonyl-L-aspartic acid |
| N-(tert-Butoxycarbonyl)-L-aspartic Acid |
| t-butoxycarbonyl-L-aspartic acid |
| Boc-L-Aspatic Acid |
| N-Boc-L-Asp-benzyl ester |
| MFCD00037279 |
| N2-((1,1-Dimethylethoxy)carbonyl)-L-asparagine, 4-nitrophenyl ester |
| N-BOC-1-ASPARTICACID |
| 4-Nitrophenyl N-(tert-butoxycarbonyl)-L-asparaginate |
| N-tert-Butyloxycarbonyl-L-aspartic acid |
| BOC-L-ASP-OH |
| Boc-D-Asp-OH |
| 4-Nitrophenyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-asparaginate |
| BOC-L-Aspatic |