Biotin-PEG3-C3-NH2
Modify Date: 2025-09-10 15:25:34
Biotin-PEG3-C3-NH2 structure
|
Common Name | Biotin-PEG3-C3-NH2 | ||
|---|---|---|---|---|
| CAS Number | 1374658-86-2 | Molecular Weight | 446.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H38N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-PEG3-C3-NH2Biotin-PEG3-C3-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Biotin-PEG3-(CH2)3-NH2 |
|---|
| Description | Biotin-PEG3-C3-NH2 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C20H38N4O5S |
|---|---|
| Molecular Weight | 446.6 |
| InChIKey | XNGTVIOREZIKAE-VBIIVCKISA-N |
| SMILES | NCCCOCCOCCOCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |