Sulfo-ara-F-NMN structure
|
Common Name | Sulfo-ara-F-NMN | ||
|---|---|---|---|---|
| CAS Number | 1374663-29-2 | Molecular Weight | 352.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14FN2O6PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sulfo-ara-F-NMNSulfo-ara-F-NMN (CZ-48) is a mimetic of nicotinamide mononucleotide (NMN). Sulfo-ara-F-NMN acts selectively, activating SARM1 but inhibiting CD38 (IC50 around 10 μM). Sulfo-ara-F-NMN induces intracellular cyclic ADP-ribose (cADPR) production[1]. |
| Name | Sulfo-ara-F-NMN |
|---|
| Description | Sulfo-ara-F-NMN (CZ-48) is a mimetic of nicotinamide mononucleotide (NMN). Sulfo-ara-F-NMN acts selectively, activating SARM1 but inhibiting CD38 (IC50 around 10 μM). Sulfo-ara-F-NMN induces intracellular cyclic ADP-ribose (cADPR) production[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Sterile alpha and Toll/interleukin-1 receptor motif-containing 1 (SARM1) is an adaptor protein in the Toll-like receptor pathway. Sulfo-ara-F-NMN activates SARM1 to produce cyclic ADP-ribose and induces non-apoptotic cell death[1]. |
| References |
| Molecular Formula | C11H14FN2O6PS |
|---|---|
| Molecular Weight | 352.28 |
| InChIKey | SIQYQBAPGWSZQF-PKIKSRDPSA-N |
| SMILES | NC(=O)c1ccc[n+](C2OC(COP([O-])(O)=S)C(O)C2F)c1 |