N,N,N-Trimethylbenzenaminium chloride structure
|
Common Name | N,N,N-Trimethylbenzenaminium chloride | ||
|---|---|---|---|---|
| CAS Number | 138-24-9 | Molecular Weight | 171.667 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14ClN | Melting Point | 246-248 °C (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of N,N,N-Trimethylbenzenaminium chlorideN,N,N-Trimethylbenzenaminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Phenyltrimethylammonium Chloride |
|---|---|
| Synonym | More Synonyms |
| Description | N,N,N-Trimethylbenzenaminium chloride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 246-248 °C (dec.)(lit.) |
|---|---|
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.667 |
| Exact Mass | 171.081482 |
| InChIKey | MQAYPFVXSPHGJM-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)c1ccccc1.[Cl-] |
| Water Solubility | soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | T:Toxic; |
|---|---|
| Risk Phrases | R24/25 |
| Safety Phrases | S53-S25-S39-S45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 1 |
| RTECS | BT2190000 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29239000 |
|
~0%
N,N,N-Trimethyl... CAS#:138-24-9 |
| Literature: Barluenga, Jose; Campos, Pedro J.; Roy, Miguel A.; Asensio, Gregorio Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1420 - 1426 |
|
~%
N,N,N-Trimethyl... CAS#:138-24-9
Detail
|
| Literature: Chemical Communications, , vol. 50, # 15 p. 1836 - 1838 |
|
~%
N,N,N-Trimethyl... CAS#:138-24-9 |
| Literature: Chemische Berichte, , vol. 42, p. 3442,3446 |
|
~%
N,N,N-Trimethyl... CAS#:138-24-9 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1420 - 1426 |
|
~%
N,N,N-Trimethyl... CAS#:138-24-9 |
| Literature: Phosphorus and Sulfur and the Related Elements, , vol. 26, p. 185 - 192 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenaminium, N,N,N-trimethyl-, chloride (1:1) |
| Trimethylphenylammonium Chloride |
| N,N,N-Trimethylbenzenaminium chloride |
| Trimethylphenylammoniumchloride |
| N,N,N-Trimethylanilinium chloride |
| trimethyl(phenyl)azanium,chloride |
| EINECS 205-319-0 |
| MFCD00011790 |
| Phenyltrimethylammonium chloride |