PF-05236216 hydrochloride structure
|
Common Name | PF-05236216 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1383376-93-9 | Molecular Weight | 358.8014 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16ClFN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-05236216 hydrochloridePF-05236216 hydrochloride is a brain penetrant, potent and selective inhibitor of casein kinase 1 delta/epsilon (CK1δ/ε) that modulates circadian rhythms in mice. |
| Name | PF-05236216 hydrochloride |
|---|
| Description | PF-05236216 hydrochloride is a brain penetrant, potent and selective inhibitor of casein kinase 1 delta/epsilon (CK1δ/ε) that modulates circadian rhythms in mice. |
|---|
| Molecular Formula | C18H16ClFN4O |
|---|---|
| Molecular Weight | 358.8014 |
| InChIKey | NGDXEOHYWJHBTJ-UHFFFAOYSA-N |
| SMILES | CN1Cc2nccc(-c3cn(C)nc3-c3ccc(F)cc3)c2C1=O |