PF-00446687 hydrochloride structure
|
Common Name | PF-00446687 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 862282-10-8 | Molecular Weight | 507.05500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H37ClF2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF-00446687 hydrochloridePF-00446687 hydrochloride (PF-446687) is a potent, selective melanocortin-4 receptor (MC4R) agonist with EC50 of 12 nM. |
| Name | [(4R)-4-(2,4-Difluorophenyl)-1-(2-methyl-2-propanyl)-3-pyrrolidin yl][(3R,5S)-4-hydroxy-3,5-dimethyl-4-phenyl-1-piperidinyl]methano ne hydrochloride (1:1) |
|---|
| Molecular Formula | C28H37ClF2N2O2 |
|---|---|
| Molecular Weight | 507.05500 |
| Exact Mass | 506.25100 |
| PSA | 43.78000 |
| LogP | 5.45870 |
| InChIKey | WWCBDWDDPAPGHX-GCTHPWIYSA-N |
| SMILES | CC1CN(C(=O)C2CN(C(C)(C)C)CC2c2ccc(F)cc2F)CC(C)C1(O)c1ccccc1.Cl |