MDM2-IN-1 structure
|
Common Name | MDM2-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 1410737-09-5 | Molecular Weight | 463.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21Cl2FN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MDM2-IN-1MDM2-IN-1 (Compound 30) is a synthetic MDM2-p53 interaction (MDM2) inhibitor and contains the trans (D-)configuration[1]. |
| Name | MDM2-IN-1 |
|---|
| Description | MDM2-IN-1 (Compound 30) is a synthetic MDM2-p53 interaction (MDM2) inhibitor and contains the trans (D-)configuration[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H21Cl2FN2O3 |
|---|---|
| Molecular Weight | 463.33 |
| InChIKey | GQQZEPFAYBPYQU-GEQKSPFYSA-N |
| SMILES | O=C(O)C1NC2(CCCCC2)C2(C(=O)Nc3cc(Cl)ccc32)C1c1cccc(Cl)c1F |