bis(4-methoxyphenyl)phenylphosphine structure
|
Common Name | bis(4-methoxyphenyl)phenylphosphine | ||
|---|---|---|---|---|
| CAS Number | 14180-51-9 | Molecular Weight | 322.33700 | |
| Density | N/A | Boiling Point | 426.9ºC at 760mmHg | |
| Molecular Formula | C20H19O2P | Melting Point | 88-90°C | |
| MSDS | N/A | Flash Point | 263.1ºC | |
| Name | bis(4-methoxyphenyl)-phenylphosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 426.9ºC at 760mmHg |
|---|---|
| Melting Point | 88-90°C |
| Molecular Formula | C20H19O2P |
| Molecular Weight | 322.33700 |
| Flash Point | 263.1ºC |
| Exact Mass | 322.11200 |
| PSA | 32.05000 |
| LogP | 3.46200 |
| Vapour Pressure | 4.25E-07mmHg at 25°C |
| InChIKey | BJPHLVZNHDIUNY-UHFFFAOYSA-N |
| SMILES | COc1ccc(P(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39-S61 |
| HS Code | 2909309090 |
|
~78%
bis(4-methoxyph... CAS#:14180-51-9 |
| Literature: Russell, Matthew G.; Warren, Stuart Tetrahedron Letters, 1998 , vol. 39, # 43 p. 7995 - 7998 |
|
~36%
bis(4-methoxyph... CAS#:14180-51-9 |
| Literature: Le Gall, Erwan; Ben Aissi, Karima; Lachaise, Isabelle; Troupel, Michel Synlett, 2006 , # 6 p. 954 - 956 |
|
~%
bis(4-methoxyph... CAS#:14180-51-9 |
| Literature: Journal of the American Chemical Society, , vol. 97, # 7 p. 1787 - 1794 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Bis-<4-methoxy-phenyl>-phenylphosphin |
| Phenyl-bis-<p-methoxy-phenyl>-phosphin |
| MFCD00048993 |