Azido-PEG4-4-nitrophenyl carbonate structure
|
Common Name | Azido-PEG4-4-nitrophenyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 1422540-98-4 | Molecular Weight | 384.341 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG4-4-nitrophenyl carbonateAzido-PEG4-4-nitrophenyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG4-4-nitrophenyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG4-4-nitrophenyl carbonate is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H20N4O8 |
|---|---|
| Molecular Weight | 384.341 |
| Exact Mass | 384.128113 |
| LogP | 1.25 |
| InChIKey | NEBKYWFZPUXXJD-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| AZIDO-PEG4-4-NITROPHENYL CARBONATE |