Anemarsaponin BIII structure
|
Common Name | Anemarsaponin BIII | ||
|---|---|---|---|---|
| CAS Number | 142759-74-8 | Molecular Weight | 903.058 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 1023.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H74O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 572.9±34.3 °C | |
Use of Anemarsaponin BIIITimosaponin B III is a major bioactive steroidal saponin isolated from Anemarrhena asphodeloides Bge, and exhibits anti-inflammatory, anti-platelet aggregative and anti-depressive effects[1][2][3]. |
| Name | pseudoprototimosaponin AIII |
|---|---|
| Synonym | More Synonyms |
| Description | Timosaponin B III is a major bioactive steroidal saponin isolated from Anemarrhena asphodeloides Bge, and exhibits anti-inflammatory, anti-platelet aggregative and anti-depressive effects[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 1023.7±65.0 °C at 760 mmHg |
| Molecular Formula | C45H74O18 |
| Molecular Weight | 903.058 |
| Flash Point | 572.9±34.3 °C |
| Exact Mass | 902.487488 |
| PSA | 287.14000 |
| LogP | 2.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | ROHLIYKWVMBBFX-GFMVILKCSA-N |
| SMILES | CC1=C(CCC(C)COC2OC(CO)C(O)C(O)C2O)OC2CC3C4CCC5CC(OC6OC(CO)C(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)CCC5(C)C4CCC3(C)C12 |
| Storage condition | 2-8℃ |
| β-D-Galactopyranoside, (3β,5β,25S)-26-(β-D-glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl- |
| (3β,5β,25S)-26-(β-D-Glucopyranosyloxy)furost-20(22)-en-3-yl 2-O-β-D-glucopyranosyl-β-D-galactopyranoside |
| anemarrhenasaponin IV |
| timosaponin B-III |
| timosaponin B |
| timosaponin BIII |
| timosaponin B III |
| anemarsaponin BIII |