Terlipressin acetate salt structure
|
Common Name | Terlipressin acetate salt | ||
|---|---|---|---|---|
| CAS Number | 14636-12-5 | Molecular Weight | 1227.372 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 1824.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C52H74N16O15S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1056.9±34.3 °C | |
Use of Terlipressin acetate saltTerlipressin is a potent vasoconstrictor that acts via V1 receptors on arteriolar smooth muscle cells. Terlipressin can result in splanchnic vasoconstriction augmenting systemic arterial blood pressure with beneficial circulatory and renal effects that would be expected to also ameliorate the key pathophysiological changes responsible for the development of refractory ascites |
| Name | Terlipressin |
|---|---|
| Synonym | More Synonyms |
| Description | Terlipressin is a potent vasoconstrictor that acts via V1 receptors on arteriolar smooth muscle cells. Terlipressin can result in splanchnic vasoconstriction augmenting systemic arterial blood pressure with beneficial circulatory and renal effects that would be expected to also ameliorate the key pathophysiological changes responsible for the development of refractory ascites |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 1824.0±65.0 °C at 760 mmHg |
| Molecular Formula | C52H74N16O15S2 |
| Molecular Weight | 1227.372 |
| Flash Point | 1056.9±34.3 °C |
| Exact Mass | 1226.496094 |
| PSA | 563.45000 |
| LogP | -6.75 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | BENFXAYNYRLAIU-QSVFAHTRSA-N |
| SMILES | NCCCCC(NC(=O)C1CCCN1C(=O)C1CSSCC(NC(=O)CNC(=O)CNC(=O)CN)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc2ccccc2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| Storage condition | -20°C |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| (2S)-1-{[(4R,7S,10S,13S,16S,19R)-19-{[({[(Aminoacetyl)amino]acetyl}amino)acetyl]amino}-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-N-{(2S)-6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxohexan-2-yl}pyrrolidine-2-carboxamide (non-preferred name) |
| Terlipressin |
| EINECS 238-680-8 |
| MFCD00155450 |
| (2S)-1-{[(4R,7S,10S,13S,16S,19R)-19-{[({[(Aminoacetyl)amino]acetyl}amino)acetyl]amino}-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-N-{(2S)-6-amino-1-[(2-amino-2-oxoethyl)amino]-1-oxo-2-hexanyl}-2-pyrrolidinecarboxamide |
| N-(N-(N-Glycylglycyl)glycyl)-8-L-lysinevasopressin |
| Terlipressin Acetate |