mPGES1-IN-17d structure
|
Common Name | mPGES1-IN-17d | ||
|---|---|---|---|---|
| CAS Number | 1469976-70-2 | Molecular Weight | 538.85 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H16ClF5N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of mPGES1-IN-17dmPGES1-IN-3 (Compound 17d) is a potent and selective microsomal prostaglandin E2 synthase-1 (mPGES-1) inhibitor, which exhibits excellent mPGES-1 enzyme (IC50: 8 nM), cell (A549 IC50: 16.24 nM) and human whole blood potency (IC50: 249.9 nM)[1]. |
| Name | mPGES1-IN-3 |
|---|
| Description | mPGES1-IN-3 (Compound 17d) is a potent and selective microsomal prostaglandin E2 synthase-1 (mPGES-1) inhibitor, which exhibits excellent mPGES-1 enzyme (IC50: 8 nM), cell (A549 IC50: 16.24 nM) and human whole blood potency (IC50: 249.9 nM)[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 8 nM (mPGES-1)[1] |
| References |
| Molecular Formula | C24H16ClF5N4O3 |
|---|---|
| Molecular Weight | 538.85 |
| InChIKey | HOTSVKDMIYWWIY-UHFFFAOYSA-N |
| SMILES | Cn1c(Nc2c(F)cccc2Cl)nc2cc(C(=O)Nc3cc(F)cc(C(F)(F)F)c3)c3c(c21)OCCO3 |