Phenyl β-D-glucopyranoside structure
|
Common Name | Phenyl β-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 1464-44-4 | Molecular Weight | 256.25 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 482.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O6 | Melting Point | 176-178ºC(lit.) | |
| MSDS | N/A | Flash Point | 245.4±28.7 °C | |
Use of Phenyl β-D-glucopyranosidePhenyl β-D-glucopyranoside has anti-cancer and anti-inflammatory activities. Phenyl β-D-glucopyranoside inhibits nitric oxide (NO) production, and the expression of iNOS and COX-2. Phenyl β-D-glucopyranoside also inhibits the nuclear translocation of NF-κB[1]. |
| Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Phenyl β-D-glucopyranoside has anti-cancer and anti-inflammatory activities. Phenyl β-D-glucopyranoside inhibits nitric oxide (NO) production, and the expression of iNOS and COX-2. Phenyl β-D-glucopyranoside also inhibits the nuclear translocation of NF-κB[1]. |
|---|---|
| Related Catalog | |
| Target |
COX-2 |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.1±45.0 °C at 760 mmHg |
| Melting Point | 176-178ºC(lit.) |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 |
| Flash Point | 245.4±28.7 °C |
| Exact Mass | 256.094696 |
| PSA | 99.38000 |
| LogP | -0.67 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | NEZJDVYDSZTRFS-RMPHRYRLSA-N |
| SMILES | OCC1OC(Oc2ccccc2)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | F,C |
|---|---|
| Safety Phrases | 16-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | LZ5985510 |
| HS Code | 2932999099 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Phenyl β-D-Glucopyranoside Hydrate |
| Phenyl β-D-glucopyranoside |
| Phenyl beta-D-glucopyranoside |
| EINECS 215-978-6 |
| MFCD00064089 |
| β-D-Glucopyranoside, phenyl |
| Phenylglucoside |
| Phenol glucoside |
| Phenyl-β-D-glucopyranoside |
| Phenyl β-D-Glucoside Hydrate |