2-MPMDQ structure
|
Common Name | 2-MPMDQ | ||
|---|---|---|---|---|
| CAS Number | 149847-77-8 | Molecular Weight | 405.49 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 578.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H27N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.5±32.9 °C | |
Use of 2-MPMDQ2-MPMDQ is a potent and selective α1-adrenoceptor (Ki=0.37 nM) antagonist over α2-adrenoceptor (Ki=1740 nM). 2-MPMDQ is potent anti-hypertensive agent and has the potential for hypertension research[1]. |
| Name | 2-{[4-(2-Methoxyphenyl)-1-piperazinyl]methyl}-6-methyl-2,6-dihydroimidazo[1,2-c]quinazolin-5(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Description | 2-MPMDQ is a potent and selective α1-adrenoceptor (Ki=0.37 nM) antagonist over α2-adrenoceptor (Ki=1740 nM). 2-MPMDQ is potent anti-hypertensive agent and has the potential for hypertension research[1]. |
|---|---|
| Related Catalog | |
| Target |
α1-adrenergic receptor:0.37 nM (Ki) α2-adrenergic receptor:1740 nM (Ki) |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.2±60.0 °C at 760 mmHg |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.49 |
| Flash Point | 303.5±32.9 °C |
| Exact Mass | 405.216461 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | OULFYKAESNCMFJ-UHFFFAOYSA-N |
| SMILES | COc1ccccc1N1CCN(CC2CN3C(=O)N(C)c4ccccc4C3=N2)CC1 |
| Imidazo[1,2-c]quinazolin-5(3H)-one, 2,6-dihydro-2-[[4-(2-methoxyphenyl)-1-piperazinyl]methyl]-6-methyl- |
| 2-{[4-(2-Methoxyphenyl)-1-piperazinyl]methyl}-6-methyl-2,6-dihydroimidazo[1,2-c]quinazolin-5(3H)-one |
| 2-{[4-(2-Methoxyphenyl)piperazin-1-yl]methyl}-6-methyl-2,6-dihydroimidazo[1,2-c]quinazolin-5(3H)-one |