Decanoyl-RVKR-CMK structure
|
Common Name | Decanoyl-RVKR-CMK | ||
|---|---|---|---|---|
| CAS Number | 150113-99-8 | Molecular Weight | 744.41 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H66ClN11O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Decanoyl-RVKR-CMKDecanoyl-RVKR-CMK (DecRVKRcmk) inhibits over-expressed gp160 processing and HIV-1 replication[1]. |
| Name | Furin Convertase Inhibitor ( Chloromethylketone) |
|---|---|
| Synonym | More Synonyms |
| Description | Decanoyl-RVKR-CMK (DecRVKRcmk) inhibits over-expressed gp160 processing and HIV-1 replication[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Decanoyl-RVKR-CMK (DecRVKRcmk) inhibits HIV-2ROD replication by blocking envelope glycoprotein precursor processing in the Jurkat lymphocyte cell[1].Decanoyl-RVKR-CMK (DecRVKRcmk) blocks regulated secretion of VGF[2]. Cell Viability Assay Cell Line: HeLaCD4 cells infected with recombinant vaccinia viruses at a multiplicity of infection (MOI) of 5 PFU/mL[1]. Concentration: 35 and 70 µΜ. Incubation Time: 7 days. Result: Peptide at 35 µM significantly inhibited ex vivo HIV-1 and HIV-2 replications (70–80% inhibition). |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C34H66ClN11O5 |
| Molecular Weight | 744.41 |
| Exact Mass | 743.493713 |
| PSA | 283.29000 |
| LogP | 3.38 |
| Index of Refraction | 1.585 |
| InChIKey | NHBJTTGFHCHQHS-VZTVMPNDSA-N |
| SMILES | CCCCCCCCCC(=O)NC(CCCN=C(N)N)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)CCl)C(C)C |
| decanoyl RVKR-CMK |
| N-Decanoyl-N-(diaminomethylene)-L-ornithyl-L-valyl-N-{(3S)-1-chloro-6-[(diaminomethylene)amino]-2-oxo-3-hexanyl}-L-lysinamide |
| decanoyl-Arg-Val-Lys-Arg-chloromethylketone |
| Decanoic acid,4-formyl-2-methoxyphenyl ester |
| L-Lysinamide, N-(diaminomethylene)-N-(1-oxodecyl)-L-ornithyl-L-valyl-N-[(1S)-1-(2-chloroacetyl)-4-[(diaminomethylene)amino]butyl]- |
| 4-formyl-2-methoxyphenyl decanoate |
| decanoyl vanillin |
| decanoyl-RVKR-chloromethylketone |
| Dec-RVKR-CMK |