5-Bromo-2-methoxy-3-nitropyridine structure
|
Common Name | 5-Bromo-2-methoxy-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 152684-30-5 | Molecular Weight | 233.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 282.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O3 | Melting Point | 88.0 to 92.0 °C | |
| MSDS | Chinese USA | Flash Point | 124.3±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Bromo-2-methoxy-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.0±35.0 °C at 760 mmHg |
| Melting Point | 88.0 to 92.0 °C |
| Molecular Formula | C6H5BrN2O3 |
| Molecular Weight | 233.020 |
| Flash Point | 124.3±25.9 °C |
| Exact Mass | 231.948349 |
| PSA | 67.94000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | YRVHFGOAEVWBNS-UHFFFAOYSA-N |
| SMILES | COc1ncc(Br)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~43%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: CGI PHARMACEUTICALS, INC. Patent: WO2008/33854 A1, 2008 ; Location in patent: Page/Page column 74 ; |
|
~10%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2009/39140 A1, 2009 ; Location in patent: Page/Page column 52 ; WO 2009/039140 A1 |
|
~72%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: CALITOR SCIENCES, LLC; SUNSHINE LAKE PHARMA CO., LTD.; XI, Ning; LI, Zhuo; WANG, Tingjin; WU, Zuping; WEN, Qiuling Patent: WO2014/22128 A1, 2014 ; Location in patent: Paragraph 0149 ; |
|
~95%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2008/157191 A2, 2008 ; Location in patent: Page/Page column 78 ; WO 2008/157191 A2 |
|
~%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: US2014/134133 A1, ; Page/Page column ; |
|
~22%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: Linstroem, Stefan; Eriksson, Mikael; Grivas, Spiros Acta Chemica Scandinavica, 1993 , vol. 47, # 8 p. 805 - 812 |
|
~%
5-Bromo-2-metho... CAS#:152684-30-5 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 22, # 4 p. 1569 - 1574 |
| Precursor 6 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-2-methoxy-3-nitropyridine |
| Pyridine, 5-bromo-2-methoxy-3-nitro- |