Fexofenadine hydrochloride structure
|
Common Name | Fexofenadine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 153439-40-8 | Molecular Weight | 538.117 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H40ClNO4 | Melting Point | 148-150oC | |
| MSDS | USA | Flash Point | N/A | |
Use of Fexofenadine hydrochlorideFexofenadine is a third-generation antihistamine pharmaceutical drug used in the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria. |
| Name | Fexofenadine Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Fexofenadine is a third-generation antihistamine pharmaceutical drug used in the treatment of allergy symptoms, such as hay fever, nasal congestion, and urticaria. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 148-150oC |
|---|---|
| Molecular Formula | C32H40ClNO4 |
| Molecular Weight | 538.117 |
| Exact Mass | 537.264587 |
| PSA | 81.00000 |
| LogP | 6.25040 |
| InChIKey | RRJFVPUCXDGFJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)c1ccc(C(O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1.Cl |
| Storage condition | −20°C |
|
Histamine inhibits differentiation of skin fibroblasts into myofibroblasts.
Biochem. Biophys. Res. Commun. 463 , 434-9, (2015) Histamine and TGF-β, major mediators secreted by mast cells, are involved in skin inflammation and play critical roles in the pathogenesis of systemic sclerosis. However, the roles of signaling mechan... |
|
|
Probiotic properties of lactic acid bacteria isolated from water-buffalo mozzarella cheese.
Probiotics Antimicrob Proteins 6 , 141-56, (2014) This study evaluated the probiotic properties (stability at different pH values and bile salt concentration, auto-aggregation and co-aggregation, survival in the presence of antibiotics and commercial... |
|
|
Substrate- and dose-dependent drug interactions with grapefruit juice caused by multiple binding sites on OATP2B1.
Pharm. Res. 31(8) , 2035-43, (2014) OATP2B1-mediated grapefruit juice (GFJ)-drug interactions are substrate-dependent; for example, GFJ ingestion significantly reduces bioavailability of fexofenadine, but not pravastatin. In the present... |
| 2-[4-(1-Hydroxy-4-{4-[hydroxy(diphenyl)methyl]piperidin-1-yl}butyl)phenyl]-2-methylpropansäurehydrochlorid |
| Fexofenidine hydrochloride MDL 16455 hydrochloride Terfenidine carboxylate hydrochloride |
| Benzeneacetic acid, 4-[1-hydroxy-4-[4-(hydroxydiphenylmethyl)-1-piperidinyl]butyl]-α,α-dimethyl-, hydrochloride (1:1) |
| Fexofenadine HCl |
| Fexofenadine hydrochloride |
| benzeneacetic acid, 4-[1-hydroxy-4-[4-(hydroxydiphenylmethyl)-1-piperidinyl]butyl]-α,α-dimethyl-, hydrochloride |
| Fexofenidine hydrochloride,MDL 16455 hydrochloride,Terfenidine carboxylate hydrochloride |
| 2-[4-(1-Hydroxy-4-{4-[hydroxy(diphenyl)methyl]piperidin-1-yl}butyl)phenyl]-2-methylpropanoic acid hydrochloride (1:1) |
| acide 2-[4-(1-hydroxy-4-{4-[hydroxy(diphényl)méthyl]pipéridin-1-yl}butyl)phényl]-2-méthylpropanoïque chlorhydrate |
| MFCD08064193 |
| UNII:2S068B75ZU |
| 2-[4-(1-hydroxy-4-{4-[hydroxy(diphenyl)methyl]piperidin-1-yl}butyl)phenyl]-2-methylpropanoic acid hydrochloride |
| 2-[4-(1-Hydroxy-4-{4-[hydroxy(diphenyl)methyl]-1-piperidinyl}butyl)phenyl]-2-methylpropanoic acid hydrochloride (1:1) |
| benzeneacetic acid, 4-[1-hydroxy-4-[4-(hydroxydiphenylmethyl)-1-piperidinyl]butyl]-a,a-dimethyl-, hydrochloride (1:1) |
| Benzeneacetic acid, 4-[1-hydroxy-4-[4-(hydroxydiphenylmethyl)-1-piperidinyl]butyl]-α,α-dimethyl-, hydrochloride |
| Fexofenadine (hydrochloride) |