5,5'-(Diazene-1,2-diyl)bis(2-hydroxybenzoic acid) structure
|
Common Name | 5,5'-(Diazene-1,2-diyl)bis(2-hydroxybenzoic acid) | ||
|---|---|---|---|---|
| CAS Number | 15722-48-2 | Molecular Weight | 302.23900 | |
| Density | 1.55g/cm3 | Boiling Point | 653.233ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 348.863ºC | |
Use of 5,5'-(Diazene-1,2-diyl)bis(2-hydroxybenzoic acid)Olsalazine is a potent inhibitor of macrophages chemotaxis to LTB4 with an IC50 value of 0.39 mM, also reduces the synthesis of 5-hydroxyeicosatetraenoic acid (5-HETE), 11-HETE, 12-HETE, and 15-HETE in polymorphonuclear leukocyte (PMNL) and mononuclear cells (MNL). Olsalazine can be used for researching ulcerative colitis. Anti-inflammatory activity[1][2]. |
| Name | olsalazine |
|---|---|
| Synonym | More Synonyms |
| Description | Olsalazine is a potent inhibitor of macrophages chemotaxis to LTB4 with an IC50 value of 0.39 mM, also reduces the synthesis of 5-hydroxyeicosatetraenoic acid (5-HETE), 11-HETE, 12-HETE, and 15-HETE in polymorphonuclear leukocyte (PMNL) and mononuclear cells (MNL). Olsalazine can be used for researching ulcerative colitis. Anti-inflammatory activity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.39 mM (LTB4)[1] |
| References |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 653.233ºC at 760 mmHg |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.23900 |
| Flash Point | 348.863ºC |
| Exact Mass | 302.05400 |
| PSA | 139.78000 |
| LogP | 2.90960 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | QQBDLJCYGRGAKP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(N=Nc2ccc(O)c(C(=O)O)c2)ccc1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| HS Code | 2927000090 |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Olsalazine |
| 5,5'-azosalicylic acid |
| Azodisal |
| Olsalazina |
| Olsalazinum [Latin] |
| 3,3'-Azobis(6-hydroxybenzoic acid) |
| 6,6'-Dihydroxy-3,3'-azo-di-benzoesaeure |
| 5,5'-Azobis(salicylic acid) |
| 6,6'-dihydroxy-3,3'-azo-di-benzoic acid |
| Eriochromflavin-A |
| C.I. Mordant Yellow 5 |
| Dipentum |
| Olsalazinum |
| MFCD00602469 |
| 5-[(2Z)-2-(3-carboxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]-2-hydroxybenzoic acid |
| Rasal |