4-(n-nonyloxy)benzoic acid structure
|
Common Name | 4-(n-nonyloxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 15872-43-2 | Molecular Weight | 264.36000 | |
| Density | 1.024g/cm3 | Boiling Point | 389.9ºC at 760mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | 143 °C | |
| MSDS | Chinese USA | Flash Point | 135.9ºC | |
| Name | 4-(n-nonyloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.024g/cm3 |
|---|---|
| Boiling Point | 389.9ºC at 760mmHg |
| Melting Point | 143 °C |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 135.9ºC |
| Exact Mass | 264.17300 |
| PSA | 46.53000 |
| LogP | 4.51420 |
| Vapour Pressure | 8.91E-07mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | BOZLUAUKDKKZHJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOc1ccc(C(=O)O)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Aldrichimica Acta 23 , 23, (1990)
|
| 4-(n-Nonyloxy)benzoic acid |
| 4-Nonyloxybenzoic acid |
| 4-nonoxybenzoic acid |
| MFCD00043501 |