N-Desmethyltamoxifen hydrochloride structure
|
Common Name | N-Desmethyltamoxifen hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 15917-65-4 | Molecular Weight | 393.94900 | |
| Density | 1.047g/cm3 | Boiling Point | 485.8ºC at 760mmHg | |
| Molecular Formula | C25H28ClNO | Melting Point | 225-227ºC | |
| MSDS | Chinese USA | Flash Point | 213.2ºC | |
| Symbol |
GHS08, GHS09 |
Signal Word | Danger | |
Use of N-Desmethyltamoxifen hydrochlorideN-Desmethyltamoxifen hydrochloride is the major metabolite of tamoxifen in humans. N-Desmethyltamoxifen, a poor antiestrogen, is a ten-fold more potent protein kinase C (PKC) inhibitor than Tamoxifen. N-Desmethyltamoxifen hydrochloride is also a potent regulator of ceramide metabolism in human AML cells, limiting ceramide glycosylation, hydrolysis, and sphingosine phosphorylation[1][2][3]. |
| Name | N-Desmethyl Tamoxifen Hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | N-Desmethyltamoxifen hydrochloride is the major metabolite of tamoxifen in humans. N-Desmethyltamoxifen, a poor antiestrogen, is a ten-fold more potent protein kinase C (PKC) inhibitor than Tamoxifen. N-Desmethyltamoxifen hydrochloride is also a potent regulator of ceramide metabolism in human AML cells, limiting ceramide glycosylation, hydrolysis, and sphingosine phosphorylation[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | N-desmethyltamoxifen hydrochloride (20-500 ng/ml; 48 hours) has a profound inhibitory effect upon all seven glioma lines (T98G, U87, U138, U373, ALW, AUK, CAS cells)[1]. N-desmethyltamoxifen hydrochloride (1.5-10 μM; 114 hours) inhibits growth of MCF 7 human mammary carcinoma cells[2]. N-desmethyltamoxifen hydrochloride, resulting from the CYP3A4/5-mediated catalysis of tamoxifen, is the major primary quantitative metabolite of tamoxifen[3]. Cell Viability Assay[2] Cell Line: MCF 7 human mammary carcinoma cells Concentration: 1.5, 2.5, 5, 7.5, 10 μM Incubation Time: 114 hours Result: Inhibits growth of MCF 7 human mammary carcinoma cells |
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 485.8ºC at 760mmHg |
| Melting Point | 225-227ºC |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.94900 |
| Flash Point | 213.2ºC |
| Exact Mass | 393.18600 |
| PSA | 21.26000 |
| LogP | 6.84680 |
| Vapour Pressure | 8.21E-11mmHg at 25°C |
| InChIKey | GMLHJWZEYLTNJW-BJFQDICYSA-N |
| SMILES | CCC(=C(c1ccccc1)c1ccc(OCCNC)cc1)c1ccccc1.Cl |
| Symbol |
GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H350-H360-H410 |
| Precautionary Statements | P201-P280-P308 + P313 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
| Risk Phrases | 45-46-60-50/53 |
| Safety Phrases | 53-45-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| (Z)-2-[4-(1,2-Diphenyl-1-butenyl)phenoxy]-N-methylethanamine Hydrochloride |
| N-Demethyltamoxifen Hydrochlorid |
| (Z)-2-(p-(1,2-Diphenyl-1-butenyl)phenoxy)-N-methylethylamine ICI 55,548 |