N-(3-Chloro-4-fluorophenyl)-7-fluoro-6-nitro-4-quinazolinamine structure
|
Common Name | N-(3-Chloro-4-fluorophenyl)-7-fluoro-6-nitro-4-quinazolinamine | ||
|---|---|---|---|---|
| CAS Number | 162012-67-1 | Molecular Weight | 336.681 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 488.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H7ClF2N4O2 | Melting Point | 242-244℃ | |
| MSDS | N/A | Flash Point | 249.3±28.7 °C | |
| Name | N-(3-Chloro-4-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.6±45.0 °C at 760 mmHg |
| Melting Point | 242-244℃ |
| Molecular Formula | C14H7ClF2N4O2 |
| Molecular Weight | 336.681 |
| Flash Point | 249.3±28.7 °C |
| Exact Mass | 336.022552 |
| PSA | 83.63000 |
| LogP | 3.59 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | CJOJDNRJDBWZKM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Quinazolinamine, N-(3-chloro-4-fluorophenyl)-7-fluoro-6-nitro- |
| N-(3-chloro-4-fluorophenyl)-7-fluoro-6-nitroquinazolin-4-amine |
| N-(3-Chloro-4-fluorophenyl)-7-fluoro-6-nitro-4-quinazolinamine |