7-Epi-10-oxo-docetaxel structure
|
Common Name | 7-Epi-10-oxo-docetaxel | ||
|---|---|---|---|---|
| CAS Number | 162784-72-7 | Molecular Weight | 805.86300 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 887.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C43H51NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 490.4±34.3 °C | |
Use of 7-Epi-10-oxo-docetaxel7-Epi-10-oxo-docetaxel (Docetaxel Impurity D) is a impurity of docetaxel detected by high performance liquid chromatography (HPLC). |
| Name | (2α,5β,7α,13α)-4-Acetoxy-1,7-dihydroxy-13-{[(2R,3S)-2-hydroxy-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoyl]oxy}-9,10-dioxo-5,20-epoxytax-11-en-2-yl benzoate |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Epi-10-oxo-docetaxel (Docetaxel Impurity D) is a impurity of docetaxel detected by high performance liquid chromatography (HPLC). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 887.3±65.0 °C at 760 mmHg |
| Molecular Formula | C43H51NO14 |
| Molecular Weight | 805.86300 |
| Flash Point | 490.4±34.3 °C |
| Exact Mass | 805.33100 |
| PSA | 224.78000 |
| LogP | 6.29 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | ZOLQDWANVNOXBK-JSBGVCCUSA-N |
| SMILES | CC(=O)OC12COC1CC(O)C1(C)C(=O)C(=O)C3=C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |
| Storage condition | 2-8℃ |
| (2b,5b,7a,13a)-4-Acetoxy-13-(((2R,3S)-3-[(tert-butoxycarbonyl)amino]-2-hydroxy-3-phenylpropanoyl)oxy)-1,7-dihydroxy-9,10-dioxo-5,20-epoxytax-11-en-2-yl Benzoate |
| (2α,5β,7α,13α)-4-Acetoxy-1,7-dihydroxy-13-{[(2R,3S)-2-hydroxy-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-3-phenylpropanoyl]oxy}-9,10-dioxo-5,20-epoxytax-11-en-2-yl benzoate |
| 7-Epi-10-oxo-docetaxel |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-α-hydroxy-, (2aR,4R,4aS,9S,11S,12S,12aR,12bS)-12b-(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-di hydroxy-4a,8,13,13-tetramethyl-5,6-dioxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, (αR,βS)- |
| UNII-23YRN771SO |