m-PEG6-amino-Mal structure
|
Common Name | m-PEG6-amino-Mal | ||
|---|---|---|---|---|
| CAS Number | 1644231-07-1 | Molecular Weight | 446.492 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 604.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H34N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.4±31.5 °C | |
Use of m-PEG6-amino-Malm-PEG6-amino-Mal is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | MPEG6-Mal |
|---|---|
| Synonym | More Synonyms |
| Description | m-PEG6-amino-Mal is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 604.5±55.0 °C at 760 mmHg |
| Molecular Formula | C20H34N2O9 |
| Molecular Weight | 446.492 |
| Flash Point | 319.4±31.5 °C |
| Exact Mass | 446.226440 |
| LogP | -2.78 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | BPYWOIZSFVKCGV-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| 1H-Pyrrole-1-propanamide, N-3,6,9,12,15,18-hexaoxanonadec-1-yl-2,5-dihydro-2,5-dioxo- |
| 3-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)-N-(2,5,8,11,14,17-hexaoxanonadecan-19-yl)propanamide |
| MFCD27977520 |