Methyltetrazine-PEG5-NHS ester
Modify Date: 2025-08-27 09:10:31
Methyltetrazine-PEG5-NHS ester structure
|
Common Name | Methyltetrazine-PEG5-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 1802907-92-1 | Molecular Weight | 533.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H31N5O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Methyltetrazine-PEG5-NHS esterMethyltetrazine-PEG5-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Methyltetrazine-PEG5-NHS ester |
|---|
| Description | Methyltetrazine-PEG5-NHS ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C24H31N5O9 |
|---|---|
| Molecular Weight | 533.53 |
| InChIKey | SWSUSQWZOPGVKP-UHFFFAOYSA-N |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCOCCC(=O)ON3C(=O)CCC3=O)cc2)nn1 |