Phthalanilide structure
|
Common Name | Phthalanilide | ||
|---|---|---|---|---|
| CAS Number | 16497-41-9 | Molecular Weight | 316.35300 | |
| Density | 1.279g/cm3 | Boiling Point | 382.9ºC at 760mmHg | |
| Molecular Formula | C20H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117ºC | |
| Name | Phthalanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760mmHg |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.35300 |
| Flash Point | 117ºC |
| Exact Mass | 316.12100 |
| PSA | 58.20000 |
| LogP | 4.33720 |
| Vapour Pressure | 4.56E-06mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | ZYACJWRVLBPZNG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1ccccc1C(=O)Nc1ccccc1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-Diphenylphthalamide |
| 1-N,2-N-diphenylbenzene-1,2-dicarboxamide |
| PHTHALANILIDE |
| Phthaldianilide |