2-Propenoic acid,2-methyl-, 4-nitrophenyl ester structure
|
Common Name | 2-Propenoic acid,2-methyl-, 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 16522-41-1 | Molecular Weight | 207.18300 | |
| Density | 1.241g/cm3 | Boiling Point | 345.4ºC at 760mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | (4-nitrophenyl) 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 345.4ºC at 760mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Flash Point | 162.3ºC |
| Exact Mass | 207.05300 |
| PSA | 72.12000 |
| LogP | 2.59950 |
| Vapour Pressure | 6.15E-05mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | NACSMDAZDYUKMU-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
|
~62%
2-Propenoic aci... CAS#:16522-41-1 |
| Literature: Thamizharasi; Gnanasundaram Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2001 , vol. 40, # 3 p. 288 - 292 |
|
~56%
2-Propenoic aci... CAS#:16522-41-1 |
| Literature: Grigg, Ronald; Monteith, Michael; Sridharan, Visuvanathar; Terrier, Catherine Tetrahedron, 1998 , vol. 54, # 15 p. 3885 - 3894 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| methacrylic acid-(4-nitro-phenyl ester) |
| T0501-8449 |
| p-nitrophenyl methacrylate |
| Methacrylsaeure-(4-nitro-phenylester) |
| 4-NITROPHENYL METHACRYLATE |