Indisulam structure
|
Common Name | Indisulam | ||
|---|---|---|---|---|
| CAS Number | 165668-41-7 | Molecular Weight | 385.846 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 668.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C14H12ClN3O4S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 358.4±34.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of IndisulamIndisulam (E 7070) is a carbonic anhydrase inhibitor and a G1-targeting agent. Indisulam causes a blockade in the G1/S transition through inhibition of the activation of both cyclin-dependent kinase 2 (CDK2) and cyclin E. Shows anti-tumor activity in human colon and lung cancer cells[1][2]. |
| Name | 4-N-(3-chloro-1H-indol-7-yl)benzene-1,4-disulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Indisulam (E 7070) is a carbonic anhydrase inhibitor and a G1-targeting agent. Indisulam causes a blockade in the G1/S transition through inhibition of the activation of both cyclin-dependent kinase 2 (CDK2) and cyclin E. Shows anti-tumor activity in human colon and lung cancer cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Carbonic anhydrase[1]. |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 668.9±65.0 °C at 760 mmHg |
| Molecular Formula | C14H12ClN3O4S2 |
| Molecular Weight | 385.846 |
| Flash Point | 358.4±34.3 °C |
| Exact Mass | 384.995789 |
| PSA | 138.88000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | SETFNECMODOHTO-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)Nc2cccc3c(Cl)c[nH]c23)cc1 |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| E7070 |
| Indisulam (IND) |
| 1,4-Benzenedisulfonamide, N-(3-chloro-1H-indol-7-yl)- |
| indisulam |
| N-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| N-(3-Chloro-1H-indol-7-yl)benzene-1,4-disulfonamide |
| Indisulam (USAN/INN) |
| 1,4-Benzenedisulfonamide,N-(3-chloro-1H-indol-7-yl) |