4,4'-Biphenyldiyldimethanol structure
|
Common Name | 4,4'-Biphenyldiyldimethanol | ||
|---|---|---|---|---|
| CAS Number | 1667-12-5 | Molecular Weight | 214.260 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 416.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | 191-192°C | |
| MSDS | USA | Flash Point | 204.5±21.9 °C | |
| Name | 4,4'-Bis(hydroxymethyl)biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 416.3±40.0 °C at 760 mmHg |
| Melting Point | 191-192°C |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.260 |
| Flash Point | 204.5±21.9 °C |
| Exact Mass | 214.099380 |
| PSA | 40.46000 |
| LogP | 1.61 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | SFHGONLFTNHXDX-UHFFFAOYSA-N |
| SMILES | OCc1ccc(-c2ccc(CO)cc2)cc1 |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34:Causes burns. R37:Irritating to the respiratory system. R22:Harmful if swallowed. |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 3 |
| RTECS | EK9625000 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2906299090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Biphenyl-4,4'-diyldimethanol |
| 4,4'-Biphenyldimethanol |
| 4,4'-Biphenyldiyldimethanol |
| [1,1'-Biphenyl]-4,4'-dimethanol |
| [4-[4-(hydroxymethyl)phenyl]phenyl]methanol |
| 4,4'-Bis(Hydroxymethyl)Biphenyl |
| MFCD00016713 |
| [4'-(Hydroxymethyl)[1,1'-biphenyl]-4-yl]methanol |