Triethylene glycol diacrylate structure
|
Common Name | Triethylene glycol diacrylate | ||
|---|---|---|---|---|
| CAS Number | 1680-21-3 | Molecular Weight | 258.26800 | |
| Density | 1.092 g/cm3 | Boiling Point | 338.9ºCat 760 mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 146.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092 g/cm3 |
|---|---|
| Boiling Point | 338.9ºCat 760 mmHg |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 146.6ºC |
| Exact Mass | 258.11000 |
| PSA | 71.06000 |
| LogP | 0.47800 |
| Vapour Pressure | 9.54E-05mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOC(=O)C=C |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39-28 |
| RIDADR | NONH for all modes of transport |
| RTECS | AS8150000 |
| HS Code | 2918990090 |
|
~99%
Triethylene gly... CAS#:1680-21-3 |
| Literature: Kim, Byeang Hyean; Jeong, Eun Jeong; Hwang, Gil Tae; Venkatesan, Natarajan Synthesis, 2001 , # 14 p. 2191 - 2202 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Triethylene glycol diacrylate.
Am. Ind. Hyg. Assoc. J. 42(11) , B47-8, (1981)
|
|
|
Skin irritation, basal epithelial cell proliferation, and carcinogenicity evaluations of a representative specialty acrylate and methacrylate.
Regul Toxicol Pharmacol 37(1) , 54-65, (2003) Specialty acrylates and methacrylates (SAM) comprise a large family of industrial monomers. In the late 1980s, the United States EPA and the industry SAM Panel collaborated to evaluate the potential e... |
| EINECS 216-853-9 |
| Acrylic acid,diester with triethylene glycol |
| Triethylenglycoldiacrylat |