ezatiostat structure
|
Common Name | ezatiostat | ||
|---|---|---|---|---|
| CAS Number | 168682-53-9 | Molecular Weight | 529.648 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 749.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H35N3O6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 407.2±32.9 °C | |
Use of ezatiostatEzatiostat is a glutathione analog inhibitor of glutathione S-transferase P1-1 (GSTP1-1). |
| Name | ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Ezatiostat is a glutathione analog inhibitor of glutathione S-transferase P1-1 (GSTP1-1). |
|---|---|
| Related Catalog | |
| In Vitro | Ezatiostat causes dissociation of the enzyme from the jun-N-terminal kinase/c-Jun (JNK/JUN) complex, leading to JNK activation by phosphorylation. The therapeutic action of ezatiostat appears to include both proliferation of normal myeloid progenitors as well as apoptosis of the malignant clone[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 749.7±60.0 °C at 760 mmHg |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.648 |
| Flash Point | 407.2±32.9 °C |
| Exact Mass | 529.224670 |
| PSA | 169.10000 |
| LogP | 4.27 |
| Appearance of Characters | white solid |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | GWEJFLVSOGNLSS-WPFOTENUSA-N |
| SMILES | CCOC(=O)C(N)CCC(=O)NC(CSCc1ccccc1)C(=O)NC(C(=O)OCC)c1ccccc1 |
| Storage condition | -20℃ |
| RIDADR | NONH for all modes of transport |
|---|
| Ethyl (2S)-2-amino-5-{[(2R)-3-(benzylsulfanyl)-1-{[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino}-1-oxo-2-propanyl]amino}-5-oxopentanoate |
| Ter-199 |
| TLK-199 |
| ezatiostat |
| UNII-057D10I8S8 |
| Telintra |
| Terrapin 199 |