Ezatiostat (hydrochloride) structure
|
Common Name | Ezatiostat (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 286942-97-0 | Molecular Weight | 566.109 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H36ClN3O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ezatiostat (hydrochloride)Ezatiostat hydrochloride is a glutathione analog inhibitor of glutathione S-transferase P1-1 (GSTP1-1). |
| Name | ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Ezatiostat hydrochloride is a glutathione analog inhibitor of glutathione S-transferase P1-1 (GSTP1-1). |
|---|---|
| Related Catalog | |
| In Vitro | Ezatiostat causes dissociation of the enzyme from the jun-N-terminal kinase/c-Jun (JNK/JUN) complex, leading to JNK activation by phosphorylation. The therapeutic action of ezatiostat appears to include both proliferation of normal myeloid progenitors as well as apoptosis of the malignant clone[1]. |
| References |
| Molecular Formula | C27H36ClN3O6S |
|---|---|
| Molecular Weight | 566.109 |
| Exact Mass | 565.201355 |
| PSA | 162.12000 |
| LogP | 4.77990 |
| InChIKey | XJDYQYNYISTAMO-GFDYFVENSA-N |
| SMILES | CCOC(=O)C(N)CCC(=O)NC(CSCc1ccccc1)C(=O)NC(C(=O)OCC)c1ccccc1.Cl |
| Storage condition | 2-8℃ |
| ethyl (2R)-[(4S)-4-amino-5-ethoxy-5-oxopentanoyl]-S-benzyl-L-cysteinyl-2- phenylglycinate hydrochloride |
| Ethyl (2S)-2-amino-5-{[(2R)-3-(benzylsulfanyl)-1-{[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino}-1-oxo-2-propanyl]amino}-5-oxopentanoate hydrochloride (1:1) |
| Ezatiostat hydrochloride |
| Ezatiostat HCl |
| TLK199 |
| ethyl (2S)-2-amino-5-[[(2R)-3-benzylsulfanyl-1-[[(1R)-2-ethoxy-2-oxo-1-phenylethyl]amino]-1-oxopropan-2-yl] amino]-5-oxopentanoate hydrochloride |
| TER199 |
| Glycine, L-γ-glutamyl-S-(phenylmethyl)-L-cysteinyl-2-phenyl-, diethyl ester, monohydrochloride, (2R)- |
| Ezatiostat hydrochloride (USAN) |
| Telintra(R) |
| L-gamma-Glutamyl-S-(phenylmethyl)-L-cysteinyl-2-phenylglycinediethylestermonohydrochloride |
| Ezatiostat (hydrochloride) |