Efaproxiral sodium structure
|
Common Name | Efaproxiral sodium | ||
|---|---|---|---|---|
| CAS Number | 170787-99-2 | Molecular Weight | 363.383 | |
| Density | N/A | Boiling Point | 554.5ºC at 760mmHg | |
| Molecular Formula | C20H22NNaO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.2ºC | |
Use of Efaproxiral sodiumEfaproxiral sodium is a synthetic allosteric modifier of haemoglobin (Hb), decreases Hb-oxygen (O2) binding affinity and enhances oxygenation of hypoxic tumours during radiation therapy.in vitro: Efaproxiral increases oxygen levels in hypoxic tumor tissues by binding non-covalently to the hemoglobin tetramer and decreasing hemoglobin-oxygen binding affinity. Increasing tumor oxygenation reduces tumor radioresistance. Efaproxiral can enhance the oxygenation of hypoxic tumours and function as a radiation sensitiser, increasing the effectiveness of RT. |
| Name | sodium,2-[4-[2-(3,5-dimethylanilino)-2-oxoethyl]phenoxy]-2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Efaproxiral sodium is a synthetic allosteric modifier of haemoglobin (Hb), decreases Hb-oxygen (O2) binding affinity and enhances oxygenation of hypoxic tumours during radiation therapy.in vitro: Efaproxiral increases oxygen levels in hypoxic tumor tissues by binding non-covalently to the hemoglobin tetramer and decreasing hemoglobin-oxygen binding affinity. Increasing tumor oxygenation reduces tumor radioresistance. Efaproxiral can enhance the oxygenation of hypoxic tumours and function as a radiation sensitiser, increasing the effectiveness of RT. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 554.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C20H22NNaO4 |
| Molecular Weight | 363.383 |
| Flash Point | 289.2ºC |
| Exact Mass | 363.144653 |
| PSA | 78.46000 |
| LogP | 2.46490 |
| Vapour Pressure | 3.93E-13mmHg at 25°C |
| InChIKey | SWDPIHPGORBMFR-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)cc(NC(=O)Cc2ccc(OC(C)(C)C(=O)[O-])cc2)c1.[Na+] |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Efaproxiral sodium |
| Revaproxyn |
| RSR-13 |
| Sodium 2-(4-{2-[(3,5-dimethylphenyl)amino]-2-oxoethyl}phenoxy)-2-methylpropanoate |
| RSR 13 sodium |
| Propanoic acid, 2-[4-[2-[(3,5-dimethylphenyl)amino]-2-oxoethyl]phenoxy]-2-methyl-, sodium salt (1:1) |
| Efaproxiral (sodium) |