Lup-20(29)-ene-3,28-diyl diacetate structure
|
Common Name | Lup-20(29)-ene-3,28-diyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 1721-69-3 | Molecular Weight | 526.790 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 548.1±23.0 °C at 760 mmHg | |
| Molecular Formula | C34H54O4 | Melting Point | 221-223ºC | |
| MSDS | Chinese USA | Flash Point | 258.0±21.0 °C | |
Use of Lup-20(29)-ene-3,28-diyl diacetateBetulin diacetate, a natural diterpene, is an anti-AID agent and also possesses anti-cancer activity[1][2]. |
| Name | betulin diacetate |
|---|---|
| Synonym | More Synonyms |
| Description | Betulin diacetate, a natural diterpene, is an anti-AID agent and also possesses anti-cancer activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 548.1±23.0 °C at 760 mmHg |
| Melting Point | 221-223ºC |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.790 |
| Flash Point | 258.0±21.0 °C |
| Exact Mass | 526.402222 |
| PSA | 52.60000 |
| LogP | 10.80 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | MIROITGPMGDCGI-MQXQNARFSA-N |
| SMILES | C=C(C)C1CCC2(COC(C)=O)CCC3(C)C(CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C12 |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|
| Betulin 3,28-diacetate |
| Lup-20(29)-ene-3,28-diol, diacetate |
| Betulinol diacetate |
| Einecs 217-015-5 |
| Lup-20(29)-ene-3,28-diyl diacetate |
| MFCD00017378 |