2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid structure
|
Common Name | 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 172531-37-2 | Molecular Weight | 233.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acidPROTAC Linker 14 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 14 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| Name | 11-Azido-3,6,9-trioxaundecanoic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | PROTAC Linker 14 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 14 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| References |
| Molecular Formula | C8H15N3O5 |
|---|---|
| Molecular Weight | 233.22200 |
| Exact Mass | 233.10100 |
| PSA | 114.74000 |
| Index of Refraction | 1.47 |
| InChIKey | GIXBCECBLAEYKA-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCC(=O)O |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| Azido-PEG3-carboxylate |
| 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]acetic acid |