H-Phe-ObzlTos structure
|
Common Name | H-Phe-ObzlTos | ||
|---|---|---|---|---|
| CAS Number | 1738-78-9 | Molecular Weight | 427.513 | |
| Density | 1.142g/cm3 | Boiling Point | 382.8ºC at 760mmHg | |
| Molecular Formula | C23H25NO5S | Melting Point | 168 °C | |
| MSDS | N/A | Flash Point | 220.3ºC | |
Use of H-Phe-ObzlTosH-Phe-OBzl.TosOH is a phenylalanine derivative[1]. |
| Name | 3-Phenyl-L-alanine benzyl ester 4-toluenesulphonate |
|---|---|
| Synonym | More Synonyms |
| Description | H-Phe-OBzl.TosOH is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 382.8ºC at 760mmHg |
| Melting Point | 168 °C |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.513 |
| Flash Point | 220.3ºC |
| Exact Mass | 427.145355 |
| PSA | 115.07000 |
| LogP | 5.32260 |
| Vapour Pressure | 4.62E-06mmHg at 25°C |
| InChIKey | ZLZGBBIPWXUQST-RSAXXLAASA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC(Cc1ccccc1)C(=O)OCc1ccccc1 |
| Storage condition | −20°C |
| Hazard Codes | Xi |
|---|---|
| WGK Germany | 3 |
| HS Code | 2922499990 |
|
~97%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: Xu, Ping; Lin, Wenwei; Zou, Xiaomin Synthesis, 2002 , # 8 p. 1017 - 1026 |
|
~%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: US4376766 A1, ; |
|
~92%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: O'Donnell; Cook; Rusterholz Synthesis, 1991 , # 11 p. 989 - 993 |
|
~%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: Synthesis, , # 11 p. 989 - 993 |
|
~%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: Synthesis, , # 11 p. 989 - 993 |
|
~%
H-Phe-ObzlTos CAS#:1738-78-9 |
| Literature: Letters in Organic Chemistry, , vol. 7, # 1 p. 39 - 44 |
| Precursor 6 | |
|---|---|
| DownStream 7 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1-phenyl-1,2-diaminoethane |
| Phenylalanine, phenylmethyl ester, 4-methylbenzenesulfonate (1:1) |
| TosOH*Phe-OBzl |
| PHE-OBZL TOS |
| l-phenylalanine benz |
| 1-Phenylethylenediamine |
| PHENYLALANINE-OBZL P-TOSYLATE |
| H-PHE-OBZL P-TOSYLATE |
| 1-phenyl-1,2-ethanediamine |
| D,L-Phe-OBn p-tosylate |
| D,L-phenylethylenediamine |
| 1,2-diamino-1-phenylethane |
| L-Phenylalanine benzyl ester p-toluenesulfonate |
| [1-benzyl-2-(benzyloxy)-2-oxoethyl]ammonium 4-methyl-1-benzenesulfonate |
| Benzyl phenylalaninate 4-methylbenzenesulfonate (1:1) |
| L-phenylalanine benzyl ester 4-toluenesulfonate |
| 1-phenylethylene-1,2-diamine |
| L-phenylalanine benzyl ester tosylate |
| EINECS 217-096-7 |
| MFCD00066130 |
| 1-Phenyl-ethane-1,2-diamine |
| phenylethylenediamine |
| H-L-Phe-OBzl*Tos |
| rac-Phenylalanine benzyl ester p-toluenesulfonate |
| 1,2-Ethanediamine,1-phenyl |
| L-phenylalanine, phenylmethyl ester, 4-methylbenzenesulfonate (1:1) |
| L-phenylalanine benzyl ester p-toluenesulfonate salt |
| 3-Phenyl-L-alaninebenzylester4-toluenesulphonate |
| DL-phenylalanine benzyl ester,toluene-4-sulfonate |
| DL-Phenylalanin-benzylester,Toluol-4-sulfonat |
| H-L-PHE-OBZL PTSA |
| H-PHE-OBZL.PTSA |
| H-PHE-OBZL TOS-OH |
| (2S)-1-(Benzyloxy)-1-oxo-3-phenyl-2-propanaminium 4-methylbenzenesulfonate |
| H-PHE-OBZL TOS |
| H-Phe-Obzl.TosOH |
| H-Phe-ObzlTos |